C25H19BrN4O7S — CID 3753910
1-(5-bromothiophen-2-yl)-3-(1H-indol-3-ylmethyl)-5-[(5-nitrofuran-2-yl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3753910) has the molecular formula C25H19BrN4O7S and a molecular weight of 599.42 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-3-(1H-indol-3-ylmethyl)-5-[(5-nitrofuran-2-yl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(5-bromothiophen-2-yl)-3-(1H-indol-3-ylmethyl)-5-[(5-nitrofuran-2-yl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3753910 |
| Molecular Formula | C25H19BrN4O7S |
| Molecular Weight | 599.42 g/mol |
| Exact Mass | 598.02 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-3-(1H-indol-3-ylmethyl)-5-[(5-nitrofuran-2-yl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3ccc(Br)s3)NC(Cc3c[nH]c4ccccc34)(C(=O)O)C2C(=O)N1Cc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C25H19BrN4O7S/c26-17-7-6-16(38-17)21-19-20(23(32)29(22(19)31)11-13-5-8-18(37-13)30(35)36)25(28-21,24(33)34)9-12-10-27-15-4-2-1-3-14(12)15/h1-8,10,19-21,27-28H,9,11H2,(H,33,34) |
| InChIKey | ITRPCFHDQALTQI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 158.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|