C26H27F3N2O6 — CID 3402249
5-butyl-3-(1-hydroxyethyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3402249) has the molecular formula C26H27F3N2O6 and a molecular weight of 520.50 g/mol. Its IUPAC name is 5-butyl-3-(1-hydroxyethyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-butyl-3-(1-hydroxyethyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3402249 |
| Molecular Formula | C26H27F3N2O6 |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 5-butyl-3-(1-hydroxyethyl)-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCCCN1C(=O)C2C(c3cccc(Oc4cccc(C(F)(F)F)c4)c3)NC(C(=O)O)(C(C)O)C2C1=O |
| InChI | InChI=1S/C26H27F3N2O6/c1-3-4-11-31-22(33)19-20(23(31)34)25(14(2)32,24(35)36)30-21(19)15-7-5-9-17(12-15)37-18-10-6-8-16(13-18)26(27,28)29/h5-10,12-14,19-21,30,32H,3-4,11H2,1-2H3,(H,35,36) |
| InChIKey | DGHNMVCMOMDCIX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|