C26H27FN2O5 — CID 25322260
ethyl (1S,3S,3aS,6aS)-5-(3-acetylphenyl)-1-(3-fluorophenyl)-4,6-dioxo-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 25322260) has the molecular formula C26H27FN2O5 and a molecular weight of 466.51 g/mol. Its IUPAC name is ethyl (1S,3S,3aS,6aS)-5-(3-acetylphenyl)-1-(3-fluorophenyl)-4,6-dioxo-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | ethyl (1S,3S,3aS,6aS)-5-(3-acetylphenyl)-1-(3-fluorophenyl)-4,6-dioxo-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 25322260 |
| Molecular Formula | C26H27FN2O5 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | ethyl (1S,3S,3aS,6aS)-5-(3-acetylphenyl)-1-(3-fluorophenyl)-4,6-dioxo-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCC[C@]1(C(=O)OCC)N[C@H](c2cccc(F)c2)[C@H]2C(=O)N(c3cccc(C(C)=O)c3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C26H27FN2O5/c1-4-12-26(25(33)34-5-2)21-20(22(28-26)17-9-6-10-18(27)13-17)23(31)29(24(21)32)19-11-7-8-16(14-19)15(3)30/h6-11,13-14,20-22,28H,4-5,12H2,1-3H3/t20-,21+,22+,26-/m0/s1 |
| InChIKey | FCULXOJOCRGMOG-BOCITWAFSA-N |
| XLogP | 3.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|