C27H29FN2O5 — CID 92586860
ethyl (1R,3S,3aR,6aS)-5-(3-acetylphenyl)-3-butyl-1-(3-fluorophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 92586860) has the molecular formula C27H29FN2O5 and a molecular weight of 480.54 g/mol. Its IUPAC name is ethyl (1R,3S,3aR,6aS)-5-(3-acetylphenyl)-3-butyl-1-(3-fluorophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | ethyl (1R,3S,3aR,6aS)-5-(3-acetylphenyl)-3-butyl-1-(3-fluorophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 92586860 |
| Molecular Formula | C27H29FN2O5 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | ethyl (1R,3S,3aR,6aS)-5-(3-acetylphenyl)-3-butyl-1-(3-fluorophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCCC[C@]1(C(=O)OCC)N[C@@H](c2cccc(F)c2)[C@H]2C(=O)N(c3cccc(C(C)=O)c3)C(=O)[C@H]21 |
| InChI | InChI=1S/C27H29FN2O5/c1-4-6-13-27(26(34)35-5-2)22-21(23(29-27)18-10-7-11-19(28)14-18)24(32)30(25(22)33)20-12-8-9-17(15-20)16(3)31/h7-12,14-15,21-23,29H,4-6,13H2,1-3H3/t21-,22-,23-,27-/m0/s1 |
| InChIKey | QMWSLUVQCDFLSI-FAWUNYRSSA-N |
| XLogP | 3.97 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|