C23H21F3N2O5 — CID 3812037
5-(4-ethylphenyl)-3-methyl-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3812037) has the molecular formula C23H21F3N2O5 and a molecular weight of 462.42 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-3-methyl-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(4-ethylphenyl)-3-methyl-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3812037 |
| Molecular Formula | C23H21F3N2O5 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 5-(4-ethylphenyl)-3-methyl-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCc1ccc(N2C(=O)C3C(c4cccc(OC(F)(F)F)c4)NC(C)(C(=O)O)C3C2=O)cc1 |
| InChI | InChI=1S/C23H21F3N2O5/c1-3-12-7-9-14(10-8-12)28-19(29)16-17(20(28)30)22(2,21(31)32)27-18(16)13-5-4-6-15(11-13)33-23(24,25)26/h4-11,16-18,27H,3H2,1-2H3,(H,31,32) |
| InChIKey | VMYLSTGQIJYDDM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|