C25H24ClF3N4O6 — CID 3687279
3-[3-(carbamoylamino)propyl]-5-(3-chloro-4-methylphenyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3687279) has the molecular formula C25H24ClF3N4O6 and a molecular weight of 568.94 g/mol. Its IUPAC name is 3-[3-(carbamoylamino)propyl]-5-(3-chloro-4-methylphenyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-[3-(carbamoylamino)propyl]-5-(3-chloro-4-methylphenyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3687279 |
| Molecular Formula | C25H24ClF3N4O6 |
| Molecular Weight | 568.94 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | 3-[3-(carbamoylamino)propyl]-5-(3-chloro-4-methylphenyl)-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1ccc(N2C(=O)C3C(c4cccc(OC(F)(F)F)c4)NC(CCCNC(N)=O)(C(=O)O)C3C2=O)cc1Cl |
| InChI | InChI=1S/C25H24ClF3N4O6/c1-12-6-7-14(11-16(12)26)33-20(34)17-18(21(33)35)24(22(36)37,8-3-9-31-23(30)38)32-19(17)13-4-2-5-15(10-13)39-25(27,28)29/h2,4-7,10-11,17-19,32H,3,8-9H2,1H3,(H,36,37)(H3,30,31,38) |
| InChIKey | NNMIPZJBHSJMQO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.94 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|