C23H18ClN3O6 — CID 3738349
3-(carboxymethyl)-5-(3-chloro-4-methylphenyl)-1-(4-cyanophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3738349) has the molecular formula C23H18ClN3O6 and a molecular weight of 467.87 g/mol. Its IUPAC name is 3-(carboxymethyl)-5-(3-chloro-4-methylphenyl)-1-(4-cyanophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(carboxymethyl)-5-(3-chloro-4-methylphenyl)-1-(4-cyanophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3738349 |
| Molecular Formula | C23H18ClN3O6 |
| Molecular Weight | 467.87 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 3-(carboxymethyl)-5-(3-chloro-4-methylphenyl)-1-(4-cyanophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1ccc(N2C(=O)C3C(c4ccc(C#N)cc4)NC(CC(=O)O)(C(=O)O)C3C2=O)cc1Cl |
| InChI | InChI=1S/C23H18ClN3O6/c1-11-2-7-14(8-15(11)24)27-20(30)17-18(21(27)31)23(22(32)33,9-16(28)29)26-19(17)13-5-3-12(10-25)4-6-13/h2-8,17-19,26H,9H2,1H3,(H,28,29)(H,32,33) |
| InChIKey | KWJCNKFYQUHPEJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 147.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.87 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|