C28H23F3N4O6 — CID 3455475
3-[(4-nitrophenyl)methyl]-4,6-dioxo-5-(2-pyridin-2-ylethyl)-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3455475) has the molecular formula C28H23F3N4O6 and a molecular weight of 568.51 g/mol. Its IUPAC name is 3-[(4-nitrophenyl)methyl]-4,6-dioxo-5-(2-pyridin-2-ylethyl)-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-[(4-nitrophenyl)methyl]-4,6-dioxo-5-(2-pyridin-2-ylethyl)-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3455475 |
| Molecular Formula | C28H23F3N4O6 |
| Molecular Weight | 568.51 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 3-[(4-nitrophenyl)methyl]-4,6-dioxo-5-(2-pyridin-2-ylethyl)-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3cccc(C(F)(F)F)c3)NC(Cc3ccc([N+](=O)[O-])cc3)(C(=O)O)C2C(=O)N1CCc1ccccn1 |
| InChI | InChI=1S/C28H23F3N4O6/c29-28(30,31)18-5-3-4-17(14-18)23-21-22(25(37)34(24(21)36)13-11-19-6-1-2-12-32-19)27(33-23,26(38)39)15-16-7-9-20(10-8-16)35(40)41/h1-10,12,14,21-23,33H,11,13,15H2,(H,38,39) |
| InChIKey | PUXSGEVIXMEMTR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 142.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|