C32H33N3O5 — CID 5005310
5-(2,6-diethylphenyl)-1-(9-ethylcarbazol-3-yl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5005310) has the molecular formula C32H33N3O5 and a molecular weight of 539.63 g/mol. Its IUPAC name is 5-(2,6-diethylphenyl)-1-(9-ethylcarbazol-3-yl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(2,6-diethylphenyl)-1-(9-ethylcarbazol-3-yl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5005310 |
| Molecular Formula | C32H33N3O5 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 5-(2,6-diethylphenyl)-1-(9-ethylcarbazol-3-yl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCc1cccc(CC)c1N1C(=O)C2C(c3ccc4c(c3)c3ccccc3n4CC)NC(CO)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C32H33N3O5/c1-4-18-10-9-11-19(5-2)28(18)35-29(37)25-26(30(35)38)32(17-36,31(39)40)33-27(25)20-14-15-24-22(16-20)21-12-7-8-13-23(21)34(24)6-3/h7-16,25-27,33,36H,4-6,17H2,1-3H3,(H,39,40) |
| InChIKey | KVHGVEWXMAPOAM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|