C32H34N2O7 — CID 3560526
5-(2,6-diethylphenyl)-3-(hydroxymethyl)-1-(3-methoxy-2-phenylmethoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3560526) has the molecular formula C32H34N2O7 and a molecular weight of 558.63 g/mol. Its IUPAC name is 5-(2,6-diethylphenyl)-3-(hydroxymethyl)-1-(3-methoxy-2-phenylmethoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(2,6-diethylphenyl)-3-(hydroxymethyl)-1-(3-methoxy-2-phenylmethoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3560526 |
| Molecular Formula | C32H34N2O7 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 5-(2,6-diethylphenyl)-3-(hydroxymethyl)-1-(3-methoxy-2-phenylmethoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCc1cccc(CC)c1N1C(=O)C2C(c3cccc(OC)c3OCc3ccccc3)NC(CO)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C32H34N2O7/c1-4-20-13-9-14-21(5-2)27(20)34-29(36)24-25(30(34)37)32(18-35,31(38)39)33-26(24)22-15-10-16-23(40-3)28(22)41-17-19-11-7-6-8-12-19/h6-16,24-26,33,35H,4-5,17-18H2,1-3H3,(H,38,39) |
| InChIKey | GNXAFFJNTVSEIM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|