C27H30N2O8 — CID 3290445
5-tert-butyl-3-(carboxymethyl)-1-(3-methoxy-2-phenylmethoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3290445) has the molecular formula C27H30N2O8 and a molecular weight of 510.54 g/mol. Its IUPAC name is 5-tert-butyl-3-(carboxymethyl)-1-(3-methoxy-2-phenylmethoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-tert-butyl-3-(carboxymethyl)-1-(3-methoxy-2-phenylmethoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3290445 |
| Molecular Formula | C27H30N2O8 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 5-tert-butyl-3-(carboxymethyl)-1-(3-methoxy-2-phenylmethoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1cccc(C2NC(CC(=O)O)(C(=O)O)C3C(=O)N(C(C)(C)C)C(=O)C23)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H30N2O8/c1-26(2,3)29-23(32)19-20(24(29)33)27(25(34)35,13-18(30)31)28-21(19)16-11-8-12-17(36-4)22(16)37-14-15-9-6-5-7-10-15/h5-12,19-21,28H,13-14H2,1-4H3,(H,30,31)(H,34,35) |
| InChIKey | JUNILBXBNPDVAU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|