C25H27ClN2O5 — CID 5189419
5-tert-butyl-1-(4-chlorophenyl)-4,6-dioxo-3-(phenylmethoxymethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5189419) has the molecular formula C25H27ClN2O5 and a molecular weight of 470.95 g/mol. Its IUPAC name is 5-tert-butyl-1-(4-chlorophenyl)-4,6-dioxo-3-(phenylmethoxymethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-tert-butyl-1-(4-chlorophenyl)-4,6-dioxo-3-(phenylmethoxymethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5189419 |
| Molecular Formula | C25H27ClN2O5 |
| Molecular Weight | 470.95 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 5-tert-butyl-1-(4-chlorophenyl)-4,6-dioxo-3-(phenylmethoxymethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(C)(C)N1C(=O)C2C(c3ccc(Cl)cc3)NC(COCc3ccccc3)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C25H27ClN2O5/c1-24(2,3)28-21(29)18-19(22(28)30)25(23(31)32,14-33-13-15-7-5-4-6-8-15)27-20(18)16-9-11-17(26)12-10-16/h4-12,18-20,27H,13-14H2,1-3H3,(H,31,32) |
| InChIKey | OYVYSRFKCSOUMQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.95 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|