C27H24N2O5 — CID 3869886
4,6-dioxo-3-(phenylmethoxymethyl)-1-(4-phenylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3869886) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is 4,6-dioxo-3-(phenylmethoxymethyl)-1-(4-phenylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 4,6-dioxo-3-(phenylmethoxymethyl)-1-(4-phenylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3869886 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 4,6-dioxo-3-(phenylmethoxymethyl)-1-(4-phenylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1NC(=O)C2C1C(c1ccc(-c3ccccc3)cc1)NC2(COCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H24N2O5/c30-24-21-22(25(31)28-24)27(26(32)33,16-34-15-17-7-3-1-4-8-17)29-23(21)20-13-11-19(12-14-20)18-9-5-2-6-10-18/h1-14,21-23,29H,15-16H2,(H,32,33)(H,28,30,31) |
| InChIKey | LHHAYGRSFJUHHN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|