C32H32N2O5 — CID 3832917
5-tert-butyl-1-(9H-fluoren-2-yl)-4,6-dioxo-3-(phenylmethoxymethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3832917) has the molecular formula C32H32N2O5 and a molecular weight of 524.62 g/mol. Its IUPAC name is 5-tert-butyl-1-(9H-fluoren-2-yl)-4,6-dioxo-3-(phenylmethoxymethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-tert-butyl-1-(9H-fluoren-2-yl)-4,6-dioxo-3-(phenylmethoxymethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3832917 |
| Molecular Formula | C32H32N2O5 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 5-tert-butyl-1-(9H-fluoren-2-yl)-4,6-dioxo-3-(phenylmethoxymethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(C)(C)N1C(=O)C2C(c3ccc4c(c3)Cc3ccccc3-4)NC(COCc3ccccc3)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C32H32N2O5/c1-31(2,3)34-28(35)25-26(29(34)36)32(30(37)38,18-39-17-19-9-5-4-6-10-19)33-27(25)21-13-14-24-22(16-21)15-20-11-7-8-12-23(20)24/h4-14,16,25-27,33H,15,17-18H2,1-3H3,(H,37,38) |
| InChIKey | GDCAILBNMNCXBC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|