C26H27N3O5 — CID 3813315
5-tert-butyl-1-(4-cyanophenyl)-4,6-dioxo-3-(phenylmethoxymethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3813315) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is 5-tert-butyl-1-(4-cyanophenyl)-4,6-dioxo-3-(phenylmethoxymethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-tert-butyl-1-(4-cyanophenyl)-4,6-dioxo-3-(phenylmethoxymethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3813315 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 5-tert-butyl-1-(4-cyanophenyl)-4,6-dioxo-3-(phenylmethoxymethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(C)(C)N1C(=O)C2C(c3ccc(C#N)cc3)NC(COCc3ccccc3)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C26H27N3O5/c1-25(2,3)29-22(30)19-20(23(29)31)26(24(32)33,15-34-14-17-7-5-4-6-8-17)28-21(19)18-11-9-16(13-27)10-12-18/h4-12,19-21,28H,14-15H2,1-3H3,(H,32,33) |
| InChIKey | WNZCZMWUVNRWOU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|