C28H29N3O4 — CID 3695304
5-benzyl-1-(4-cyanophenyl)-3-(cyclohexylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3695304) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is 5-benzyl-1-(4-cyanophenyl)-3-(cyclohexylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-benzyl-1-(4-cyanophenyl)-3-(cyclohexylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3695304 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 5-benzyl-1-(4-cyanophenyl)-3-(cyclohexylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | N#Cc1ccc(C2NC(CC3CCCCC3)(C(=O)O)C3C(=O)N(Cc4ccccc4)C(=O)C23)cc1 |
| InChI | InChI=1S/C28H29N3O4/c29-16-19-11-13-21(14-12-19)24-22-23(26(33)31(25(22)32)17-20-9-5-2-6-10-20)28(30-24,27(34)35)15-18-7-3-1-4-8-18/h2,5-6,9-14,18,22-24,30H,1,3-4,7-8,15,17H2,(H,34,35) |
| InChIKey | KBDUPPKPTCPDRH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|