C24H25BrN4O5 — CID 3690042
5-benzyl-1-(4-bromophenyl)-3-[3-(carbamoylamino)propyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3690042) has the molecular formula C24H25BrN4O5 and a molecular weight of 529.39 g/mol. Its IUPAC name is 5-benzyl-1-(4-bromophenyl)-3-[3-(carbamoylamino)propyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-benzyl-1-(4-bromophenyl)-3-[3-(carbamoylamino)propyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3690042 |
| Molecular Formula | C24H25BrN4O5 |
| Molecular Weight | 529.39 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | 5-benzyl-1-(4-bromophenyl)-3-[3-(carbamoylamino)propyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | NC(=O)NCCCC1(C(=O)O)NC(c2ccc(Br)cc2)C2C(=O)N(Cc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C24H25BrN4O5/c25-16-9-7-15(8-10-16)19-17-18(24(28-19,22(32)33)11-4-12-27-23(26)34)21(31)29(20(17)30)13-14-5-2-1-3-6-14/h1-3,5-10,17-19,28H,4,11-13H2,(H,32,33)(H3,26,27,34) |
| InChIKey | JOFOLOVCADPOHG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|