C22H30N4O6 — CID 5020088
5-butyl-3-[3-(carbamoylamino)propyl]-1-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5020088) has the molecular formula C22H30N4O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is 5-butyl-3-[3-(carbamoylamino)propyl]-1-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-butyl-3-[3-(carbamoylamino)propyl]-1-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5020088 |
| Molecular Formula | C22H30N4O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 5-butyl-3-[3-(carbamoylamino)propyl]-1-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCCCN1C(=O)C2C(c3ccccc3OC)NC(CCCNC(N)=O)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C22H30N4O6/c1-3-4-12-26-18(27)15-16(19(26)28)22(20(29)30,10-7-11-24-21(23)31)25-17(15)13-8-5-6-9-14(13)32-2/h5-6,8-9,15-17,25H,3-4,7,10-12H2,1-2H3,(H,29,30)(H3,23,24,31) |
| InChIKey | UHIXIBWVBSMVQS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|