C25H30N4O5 — CID 3689928
5-butyl-3-[3-(carbamoylamino)propyl]-1-naphthalen-1-yl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3689928) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 5-butyl-3-[3-(carbamoylamino)propyl]-1-naphthalen-1-yl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-butyl-3-[3-(carbamoylamino)propyl]-1-naphthalen-1-yl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3689928 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 5-butyl-3-[3-(carbamoylamino)propyl]-1-naphthalen-1-yl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCCCN1C(=O)C2C(c3cccc4ccccc34)NC(CCCNC(N)=O)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C25H30N4O5/c1-2-3-14-29-21(30)18-19(22(29)31)25(23(32)33,12-7-13-27-24(26)34)28-20(18)17-11-6-9-15-8-4-5-10-16(15)17/h4-6,8-11,18-20,28H,2-3,7,12-14H2,1H3,(H,32,33)(H3,26,27,34) |
| InChIKey | JBLAZPBXUWEFCY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|