C26H31N5O5 — CID 3703909
5-benzyl-3-[3-(carbamoylamino)propyl]-1-[4-(dimethylamino)phenyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3703909) has the molecular formula C26H31N5O5 and a molecular weight of 493.56 g/mol. Its IUPAC name is 5-benzyl-3-[3-(carbamoylamino)propyl]-1-[4-(dimethylamino)phenyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-benzyl-3-[3-(carbamoylamino)propyl]-1-[4-(dimethylamino)phenyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3703909 |
| Molecular Formula | C26H31N5O5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 5-benzyl-3-[3-(carbamoylamino)propyl]-1-[4-(dimethylamino)phenyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CN(C)c1ccc(C2NC(CCCNC(N)=O)(C(=O)O)C3C(=O)N(Cc4ccccc4)C(=O)C23)cc1 |
| InChI | InChI=1S/C26H31N5O5/c1-30(2)18-11-9-17(10-12-18)21-19-20(26(29-21,24(34)35)13-6-14-28-25(27)36)23(33)31(22(19)32)15-16-7-4-3-5-8-16/h3-5,7-12,19-21,29H,6,13-15H2,1-2H3,(H,34,35)(H3,27,28,36) |
| InChIKey | XOMYOEKSXOQKQE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|