C14H13ClN2O6 — CID 3405529
1-(5-chloro-2-hydroxyphenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3405529) has the molecular formula C14H13ClN2O6 and a molecular weight of 340.72 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxyphenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(5-chloro-2-hydroxyphenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3405529 |
| Molecular Formula | C14H13ClN2O6 |
| Molecular Weight | 340.72 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 1-(5-chloro-2-hydroxyphenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1NC(=O)C2C1C(c1cc(Cl)ccc1O)NC2(CO)C(=O)O |
| InChI | InChI=1S/C14H13ClN2O6/c15-5-1-2-7(19)6(3-5)10-8-9(12(21)16-11(8)20)14(4-18,17-10)13(22)23/h1-3,8-10,17-19H,4H2,(H,22,23)(H,16,20,21) |
| InChIKey | YMGFPRJTLMKNPA-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.72 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|