C17H14ClN3O7 — CID 3727453
1-(5-chloro-2-nitrophenyl)-3-(hydroxymethyl)-4,6-dioxo-5-prop-2-ynyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3727453) has the molecular formula C17H14ClN3O7 and a molecular weight of 407.77 g/mol. Its IUPAC name is 1-(5-chloro-2-nitrophenyl)-3-(hydroxymethyl)-4,6-dioxo-5-prop-2-ynyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(5-chloro-2-nitrophenyl)-3-(hydroxymethyl)-4,6-dioxo-5-prop-2-ynyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3727453 |
| Molecular Formula | C17H14ClN3O7 |
| Molecular Weight | 407.77 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 1-(5-chloro-2-nitrophenyl)-3-(hydroxymethyl)-4,6-dioxo-5-prop-2-ynyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | C#CCN1C(=O)C2C(c3cc(Cl)ccc3[N+](=O)[O-])NC(CO)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C17H14ClN3O7/c1-2-5-20-14(23)11-12(15(20)24)17(7-22,16(25)26)19-13(11)9-6-8(18)3-4-10(9)21(27)28/h1,3-4,6,11-13,19,22H,5,7H2,(H,25,26) |
| InChIKey | LRICRWUKFATKRA-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.77 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|