C20H16BrN3O6 — CID 3669437
1-(4-bromophenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3669437) has the molecular formula C20H16BrN3O6 and a molecular weight of 474.27 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(4-bromophenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3669437 |
| Molecular Formula | C20H16BrN3O6 |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1NC(=O)C2C1C(c1ccc(Br)cc1)NC2(Cc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C20H16BrN3O6/c21-12-5-3-11(4-6-12)16-14-15(18(26)22-17(14)25)20(23-16,19(27)28)9-10-1-7-13(8-2-10)24(29)30/h1-8,14-16,23H,9H2,(H,27,28)(H,22,25,26) |
| InChIKey | XTTVMVZYCPIPLK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|