C23H23N3O8 — CID 3671037
1-(2,4-dimethoxy-3-methylphenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3671037) has the molecular formula C23H23N3O8 and a molecular weight of 469.45 g/mol. Its IUPAC name is 1-(2,4-dimethoxy-3-methylphenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(2,4-dimethoxy-3-methylphenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3671037 |
| Molecular Formula | C23H23N3O8 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 1-(2,4-dimethoxy-3-methylphenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1ccc(C2NC(Cc3ccc([N+](=O)[O-])cc3)(C(=O)O)C3C(=O)NC(=O)C23)c(OC)c1C |
| InChI | InChI=1S/C23H23N3O8/c1-11-15(33-2)9-8-14(19(11)34-3)18-16-17(21(28)24-20(16)27)23(25-18,22(29)30)10-12-4-6-13(7-5-12)26(31)32/h4-9,16-18,25H,10H2,1-3H3,(H,29,30)(H,24,27,28) |
| InChIKey | FFLPAYWAACXDIN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|