C21H18BrN3O7 — CID 3667122
1-(5-bromo-2-methoxyphenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3667122) has the molecular formula C21H18BrN3O7 and a molecular weight of 504.29 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3667122 |
| Molecular Formula | C21H18BrN3O7 |
| Molecular Weight | 504.29 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1ccc(Br)cc1C1NC(Cc2ccc([N+](=O)[O-])cc2)(C(=O)O)C2C(=O)NC(=O)C12 |
| InChI | InChI=1S/C21H18BrN3O7/c1-32-14-7-4-11(22)8-13(14)17-15-16(19(27)23-18(15)26)21(24-17,20(28)29)9-10-2-5-12(6-3-10)25(30)31/h2-8,15-17,24H,9H2,1H3,(H,28,29)(H,23,26,27) |
| InChIKey | FSOHJESQTSRVEF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|