C36H29N3O7 — CID 6186003
5-(4-acetylphenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-[4-[(E)-2-phenylethenyl]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 6186003) has the molecular formula C36H29N3O7 and a molecular weight of 615.64 g/mol. Its IUPAC name is 5-(4-acetylphenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-[4-[(E)-2-phenylethenyl]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(4-acetylphenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-[4-[(E)-2-phenylethenyl]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 6186003 |
| Molecular Formula | C36H29N3O7 |
| Molecular Weight | 615.64 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | 5-(4-acetylphenyl)-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-[4-[(E)-2-phenylethenyl]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(=O)c1ccc(N2C(=O)C3C(c4ccc(/C=C/c5ccccc5)cc4)NC(Cc4ccc([N+](=O)[O-])cc4)(C(=O)O)C3C2=O)cc1 |
| InChI | InChI=1S/C36H29N3O7/c1-22(40)26-15-19-28(20-16-26)38-33(41)30-31(34(38)42)36(35(43)44,21-25-11-17-29(18-12-25)39(45)46)37-32(30)27-13-9-24(10-14-27)8-7-23-5-3-2-4-6-23/h2-20,30-32,37H,21H2,1H3,(H,43,44)/b8-7+ |
| InChIKey | FDZYVRWDOLZNKX-BQYQJAHWSA-N |
| XLogP | 5.48 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|