C35H30N2O4 — CID 3258976
5-(4-ethylphenyl)-4,6-dioxo-3-phenyl-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3258976) has the molecular formula C35H30N2O4 and a molecular weight of 542.64 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-4,6-dioxo-3-phenyl-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(4-ethylphenyl)-4,6-dioxo-3-phenyl-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3258976 |
| Molecular Formula | C35H30N2O4 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 5-(4-ethylphenyl)-4,6-dioxo-3-phenyl-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCc1ccc(N2C(=O)C3C(c4ccc(C=Cc5ccccc5)cc4)NC(C(=O)O)(c4ccccc4)C3C2=O)cc1 |
| InChI | InChI=1S/C35H30N2O4/c1-2-23-17-21-28(22-18-23)37-32(38)29-30(33(37)39)35(34(40)41,27-11-7-4-8-12-27)36-31(29)26-19-15-25(16-20-26)14-13-24-9-5-3-6-10-24/h3-22,29-31,36H,2H2,1H3,(H,40,41) |
| InChIKey | GKTQTOSVFFUAPM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|