C38H36N4O6 — CID 3806191
5-[(3,5-dimethylpyrazol-1-yl)methyl]-1-(3-methoxy-2-phenylmethoxyphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3806191) has the molecular formula C38H36N4O6 and a molecular weight of 644.73 g/mol. Its IUPAC name is 5-[(3,5-dimethylpyrazol-1-yl)methyl]-1-(3-methoxy-2-phenylmethoxyphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-[(3,5-dimethylpyrazol-1-yl)methyl]-1-(3-methoxy-2-phenylmethoxyphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3806191 |
| Molecular Formula | C38H36N4O6 |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | 5-[(3,5-dimethylpyrazol-1-yl)methyl]-1-(3-methoxy-2-phenylmethoxyphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1cccc(C2NC(Cc3ccc4ccccc4c3)(C(=O)O)C3C(=O)N(Cn4nc(C)cc4C)C(=O)C23)c1OCc1ccccc1 |
| InChI | InChI=1S/C38H36N4O6/c1-23-18-24(2)42(40-23)22-41-35(43)31-32(36(41)44)38(37(45)46,20-26-16-17-27-12-7-8-13-28(27)19-26)39-33(31)29-14-9-15-30(47-3)34(29)48-21-25-10-5-4-6-11-25/h4-19,31-33,39H,20-22H2,1-3H3,(H,45,46) |
| InChIKey | LWQONDUBCFJPDH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|