C31H24N4O4 — CID 3872121
1-(2-cyanophenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-5-(pyridin-2-ylmethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3872121) has the molecular formula C31H24N4O4 and a molecular weight of 516.56 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-5-(pyridin-2-ylmethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(2-cyanophenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-5-(pyridin-2-ylmethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3872121 |
| Molecular Formula | C31H24N4O4 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 1-(2-cyanophenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-5-(pyridin-2-ylmethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | N#Cc1ccccc1C1NC(Cc2ccc3ccccc3c2)(C(=O)O)C2C(=O)N(Cc3ccccn3)C(=O)C12 |
| InChI | InChI=1S/C31H24N4O4/c32-17-22-9-3-4-11-24(22)27-25-26(29(37)35(28(25)36)18-23-10-5-6-14-33-23)31(34-27,30(38)39)16-19-12-13-20-7-1-2-8-21(20)15-19/h1-15,25-27,34H,16,18H2,(H,38,39) |
| InChIKey | ZNZJKEJLCHIENP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 123.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|