C28H30BrN3O8 — CID 3704345
1-(3-bromo-4,5-dimethoxyphenyl)-3-(cyclohexylmethyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3704345) has the molecular formula C28H30BrN3O8 and a molecular weight of 616.47 g/mol. Its IUPAC name is 1-(3-bromo-4,5-dimethoxyphenyl)-3-(cyclohexylmethyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(3-bromo-4,5-dimethoxyphenyl)-3-(cyclohexylmethyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3704345 |
| Molecular Formula | C28H30BrN3O8 |
| Molecular Weight | 616.47 g/mol |
| Exact Mass | 615.12 |
| IUPAC Name | 1-(3-bromo-4,5-dimethoxyphenyl)-3-(cyclohexylmethyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1cc(C2NC(CC3CCCCC3)(C(=O)O)C3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)C23)cc(Br)c1OC |
| InChI | InChI=1S/C28H30BrN3O8/c1-39-20-12-16(11-19(29)24(20)40-2)23-21-22(28(30-23,27(35)36)14-15-7-4-3-5-8-15)26(34)31(25(21)33)17-9-6-10-18(13-17)32(37)38/h6,9-13,15,21-23,30H,3-5,7-8,14H2,1-2H3,(H,35,36) |
| InChIKey | DPKRMGHJZYMCCR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|