C23H22BrClN2O6 — CID 3813556
1-(3-bromo-4,5-dimethoxyphenyl)-5-(3-chloro-4-methylphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3813556) has the molecular formula C23H22BrClN2O6 and a molecular weight of 537.79 g/mol. Its IUPAC name is 1-(3-bromo-4,5-dimethoxyphenyl)-5-(3-chloro-4-methylphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(3-bromo-4,5-dimethoxyphenyl)-5-(3-chloro-4-methylphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3813556 |
| Molecular Formula | C23H22BrClN2O6 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 536.03 |
| IUPAC Name | 1-(3-bromo-4,5-dimethoxyphenyl)-5-(3-chloro-4-methylphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1cc(C2NC(C)(C(=O)O)C3C(=O)N(c4ccc(C)c(Cl)c4)C(=O)C23)cc(Br)c1OC |
| InChI | InChI=1S/C23H22BrClN2O6/c1-10-5-6-12(9-14(10)25)27-20(28)16-17(21(27)29)23(2,22(30)31)26-18(16)11-7-13(24)19(33-4)15(8-11)32-3/h5-9,16-18,26H,1-4H3,(H,30,31) |
| InChIKey | CUGXLDXHCPNFAW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|