C26H29BrN2O6 — CID 3851284
1-(3-bromo-4,5-dimethoxyphenyl)-5-(2,6-diethylphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3851284) has the molecular formula C26H29BrN2O6 and a molecular weight of 545.43 g/mol. Its IUPAC name is 1-(3-bromo-4,5-dimethoxyphenyl)-5-(2,6-diethylphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(3-bromo-4,5-dimethoxyphenyl)-5-(2,6-diethylphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3851284 |
| Molecular Formula | C26H29BrN2O6 |
| Molecular Weight | 545.43 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | 1-(3-bromo-4,5-dimethoxyphenyl)-5-(2,6-diethylphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCc1cccc(CC)c1N1C(=O)C2C(c3cc(Br)c(OC)c(OC)c3)NC(C)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C26H29BrN2O6/c1-6-13-9-8-10-14(7-2)21(13)29-23(30)18-19(24(29)31)26(3,25(32)33)28-20(18)15-11-16(27)22(35-5)17(12-15)34-4/h8-12,18-20,28H,6-7H2,1-5H3,(H,32,33) |
| InChIKey | QXVYEHITACHMLF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|