C13H12N2O2 — CID 106509603
3-benzyl-5-prop-2-ynylimidazolidine-2,4-dione (PubChem CID 106509603) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-benzyl-5-prop-2-ynylimidazolidine-2,4-dione.
| Compound Name | 3-benzyl-5-prop-2-ynylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 106509603 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-benzyl-5-prop-2-ynylimidazolidine-2,4-dione |
| SMILES | C#CCC1NC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C13H12N2O2/c1-2-6-11-12(16)15(13(17)14-11)9-10-7-4-3-5-8-10/h1,3-5,7-8,11H,6,9H2,(H,14,17) |
| InChIKey | LQTNURZQCBJSCP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|