C14H19N3O — CID 145459681
2-amino-3-[(4-ethylphenyl)methyl]-5,5-dimethylimidazol-4-one (PubChem CID 145459681) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-amino-3-[(4-ethylphenyl)methyl]-5,5-dimethylimidazol-4-one.
| Compound Name | 2-amino-3-[(4-ethylphenyl)methyl]-5,5-dimethylimidazol-4-one |
|---|---|
| PubChem CID | 145459681 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-amino-3-[(4-ethylphenyl)methyl]-5,5-dimethylimidazol-4-one |
| SMILES | CCc1ccc(CN2C(=O)C(C)(C)N=C2N)cc1 |
| InChI | InChI=1S/C14H19N3O/c1-4-10-5-7-11(8-6-10)9-17-12(18)14(2,3)16-13(17)15/h5-8H,4,9H2,1-3H3,(H2,15,16) |
| InChIKey | SSAWICZITPQFCL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |