C24H21N3O3 — CID 59388667
methyl 4-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]benzoate (PubChem CID 59388667) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is methyl 4-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]benzoate.
| Compound Name | methyl 4-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 59388667 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | methyl 4-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)C(c3ccccc3)(c3ccccc3)N=C2N)cc1 |
| InChI | InChI=1S/C24H21N3O3/c1-30-21(28)18-14-12-17(13-15-18)16-27-22(29)24(26-23(27)25,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15H,16H2,1H3,(H2,25,26) |
| InChIKey | PXNRDNQGJXKZEJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |