C27H28N4O2 — CID 59387294
3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]-N-butan-2-ylbenzamide (PubChem CID 59387294) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]-N-butan-2-ylbenzamide.
| Compound Name | 3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]-N-butan-2-ylbenzamide |
|---|---|
| PubChem CID | 59387294 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]-N-butan-2-ylbenzamide |
| SMILES | CCC(C)NC(=O)c1cccc(CN2C(=O)C(c3ccccc3)(c3ccccc3)N=C2N)c1 |
| InChI | InChI=1S/C27H28N4O2/c1-3-19(2)29-24(32)21-12-10-11-20(17-21)18-31-25(33)27(30-26(31)28,22-13-6-4-7-14-22)23-15-8-5-9-16-23/h4-17,19H,3,18H2,1-2H3,(H2,28,30)(H,29,32) |
| InChIKey | GDJCTCMYCKSIOM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |