C25H39N3O2 — CID 58425116
2-amino-5-butyl-3-[[4-(3-oxooctyl)phenyl]methyl]-5-propan-2-ylimidazol-4-one (PubChem CID 58425116) has the molecular formula C25H39N3O2 and a molecular weight of 413.61 g/mol. Its IUPAC name is 2-amino-5-butyl-3-[[4-(3-oxooctyl)phenyl]methyl]-5-propan-2-ylimidazol-4-one.
| Compound Name | 2-amino-5-butyl-3-[[4-(3-oxooctyl)phenyl]methyl]-5-propan-2-ylimidazol-4-one |
|---|---|
| PubChem CID | 58425116 |
| Molecular Formula | C25H39N3O2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | 2-amino-5-butyl-3-[[4-(3-oxooctyl)phenyl]methyl]-5-propan-2-ylimidazol-4-one |
| SMILES | CCCCCC(=O)CCc1ccc(CN2C(=O)C(CCCC)(C(C)C)N=C2N)cc1 |
| InChI | InChI=1S/C25H39N3O2/c1-5-7-9-10-22(29)16-15-20-11-13-21(14-12-20)18-28-23(30)25(19(3)4,17-8-6-2)27-24(28)26/h11-14,19H,5-10,15-18H2,1-4H3,(H2,26,27) |
| InChIKey | ZLUHYRFBWNXXQQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|