C28H39N3O3S — CID 70118336
2-amino-5-methyl-5-(2-methylpropyl)-3-[[3-[2-(4-pentylphenyl)sulfonylethyl]phenyl]methyl]imidazol-4-one (PubChem CID 70118336) has the molecular formula C28H39N3O3S and a molecular weight of 497.71 g/mol. Its IUPAC name is 2-amino-5-methyl-5-(2-methylpropyl)-3-[[3-[2-(4-pentylphenyl)sulfonylethyl]phenyl]methyl]imidazol-4-one.
| Compound Name | 2-amino-5-methyl-5-(2-methylpropyl)-3-[[3-[2-(4-pentylphenyl)sulfonylethyl]phenyl]methyl]imidazol-4-one |
|---|---|
| PubChem CID | 70118336 |
| Molecular Formula | C28H39N3O3S |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | 2-amino-5-methyl-5-(2-methylpropyl)-3-[[3-[2-(4-pentylphenyl)sulfonylethyl]phenyl]methyl]imidazol-4-one |
| SMILES | CCCCCc1ccc(S(=O)(=O)CCc2cccc(CN3C(=O)C(C)(CC(C)C)N=C3N)c2)cc1 |
| InChI | InChI=1S/C28H39N3O3S/c1-5-6-7-9-22-12-14-25(15-13-22)35(33,34)17-16-23-10-8-11-24(18-23)20-31-26(32)28(4,19-21(2)3)30-27(31)29/h8,10-15,18,21H,5-7,9,16-17,19-20H2,1-4H3,(H2,29,30) |
| InChIKey | YBBDHOQUNPHXHI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|