C23H26ClN3O2 — CID 58425289
2-amino-3-[(3-chlorophenyl)methyl]-5-methyl-5-(3-oxo-6-phenylhexyl)imidazol-4-one (PubChem CID 58425289) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is 2-amino-3-[(3-chlorophenyl)methyl]-5-methyl-5-(3-oxo-6-phenylhexyl)imidazol-4-one.
| Compound Name | 2-amino-3-[(3-chlorophenyl)methyl]-5-methyl-5-(3-oxo-6-phenylhexyl)imidazol-4-one |
|---|---|
| PubChem CID | 58425289 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-amino-3-[(3-chlorophenyl)methyl]-5-methyl-5-(3-oxo-6-phenylhexyl)imidazol-4-one |
| SMILES | CC1(CCC(=O)CCCc2ccccc2)N=C(N)N(Cc2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C23H26ClN3O2/c1-23(14-13-20(28)12-6-9-17-7-3-2-4-8-17)21(29)27(22(25)26-23)16-18-10-5-11-19(24)15-18/h2-5,7-8,10-11,15H,6,9,12-14,16H2,1H3,(H2,25,26) |
| InChIKey | BHLOTQDKEHKWIY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |