C26H31N3O2 — CID 58425145
2'-amino-3'-[[4-(3-oxooctyl)phenyl]methyl]spiro[1,2-dihydroindene-3,5'-imidazole]-4'-one (PubChem CID 58425145) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 2'-amino-3'-[[4-(3-oxooctyl)phenyl]methyl]spiro[1,2-dihydroindene-3,5'-imidazole]-4'-one.
| Compound Name | 2'-amino-3'-[[4-(3-oxooctyl)phenyl]methyl]spiro[1,2-dihydroindene-3,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 58425145 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 2'-amino-3'-[[4-(3-oxooctyl)phenyl]methyl]spiro[1,2-dihydroindene-3,5'-imidazole]-4'-one |
| SMILES | CCCCCC(=O)CCc1ccc(CN2C(=O)C3(CCc4ccccc43)N=C2N)cc1 |
| InChI | InChI=1S/C26H31N3O2/c1-2-3-4-8-22(30)15-14-19-10-12-20(13-11-19)18-29-24(31)26(28-25(29)27)17-16-21-7-5-6-9-23(21)26/h5-7,9-13H,2-4,8,14-18H2,1H3,(H2,27,28) |
| InChIKey | KEJHXCDUTAREDU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|