C32H48N4O3 — CID 58425391
2-amino-5-butyl-5-(cyclohexylmethyl)-3-[[4-[3-oxo-7-(2-oxopyrrolidin-1-yl)heptyl]phenyl]methyl]imidazol-4-one (PubChem CID 58425391) has the molecular formula C32H48N4O3 and a molecular weight of 536.76 g/mol. Its IUPAC name is 2-amino-5-butyl-5-(cyclohexylmethyl)-3-[[4-[3-oxo-7-(2-oxopyrrolidin-1-yl)heptyl]phenyl]methyl]imidazol-4-one.
| Compound Name | 2-amino-5-butyl-5-(cyclohexylmethyl)-3-[[4-[3-oxo-7-(2-oxopyrrolidin-1-yl)heptyl]phenyl]methyl]imidazol-4-one |
|---|---|
| PubChem CID | 58425391 |
| Molecular Formula | C32H48N4O3 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | 2-amino-5-butyl-5-(cyclohexylmethyl)-3-[[4-[3-oxo-7-(2-oxopyrrolidin-1-yl)heptyl]phenyl]methyl]imidazol-4-one |
| SMILES | CCCCC1(CC2CCCCC2)N=C(N)N(Cc2ccc(CCC(=O)CCCCN3CCCC3=O)cc2)C1=O |
| InChI | InChI=1S/C32H48N4O3/c1-2-3-20-32(23-26-10-5-4-6-11-26)30(39)36(31(33)34-32)24-27-16-14-25(15-17-27)18-19-28(37)12-7-8-21-35-22-9-13-29(35)38/h14-17,26H,2-13,18-24H2,1H3,(H2,33,34) |
| InChIKey | BHYHLDZDDFJQGA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|