C25H45N3O2 — CID 58425242
2-amino-5,5-dibutyl-3-(7-cycloheptyl-6-oxoheptyl)imidazol-4-one (PubChem CID 58425242) has the molecular formula C25H45N3O2 and a molecular weight of 419.65 g/mol. Its IUPAC name is 2-amino-5,5-dibutyl-3-(7-cycloheptyl-6-oxoheptyl)imidazol-4-one.
| Compound Name | 2-amino-5,5-dibutyl-3-(7-cycloheptyl-6-oxoheptyl)imidazol-4-one |
|---|---|
| PubChem CID | 58425242 |
| Molecular Formula | C25H45N3O2 |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 419.35 |
| IUPAC Name | 2-amino-5,5-dibutyl-3-(7-cycloheptyl-6-oxoheptyl)imidazol-4-one |
| SMILES | CCCCC1(CCCC)N=C(N)N(CCCCCC(=O)CC2CCCCCC2)C1=O |
| InChI | InChI=1S/C25H45N3O2/c1-3-5-17-25(18-6-4-2)23(30)28(24(26)27-25)19-13-9-12-16-22(29)20-21-14-10-7-8-11-15-21/h21H,3-20H2,1-2H3,(H2,26,27) |
| InChIKey | IQMGAPOOAZFAOR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|