About 1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide
1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide (PubChem CID 54171569) has the molecular formula C18H27NO
and a molecular weight of 273.42 g/mol. Its IUPAC name is 1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide.
Molecular Properties
| Compound Name | 1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide |
| PubChem CID | 54171569 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide |
| SMILES | CCCCCC1(C(=O)NCCC)CCc2ccccc21 |
| InChI | InChI=1S/C18H27NO/c1-3-5-8-12-18(17(20)19-14-4-2)13-11-15-9-6-7-10-16(15)18/h6-7,9-10H,3-5,8,11-14H2,1-2H3,(H,19,20) |
| InChIKey | OVKCLKXNCQLVQP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide?
The IUPAC name of 1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide (CID 54171569) is 1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide.
What is the SMILES notation for 1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide?
The canonical SMILES for 1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide is CCCCCC1(C(=O)NCCC)CCc2ccccc21.
What is the InChIKey of 1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide?
The InChIKey is OVKCLKXNCQLVQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO/c1-3-5-8-12-18(17(20)19-14-4-2)13-11-15-9-6-7-10-16(15)18/h6-7,9-10H,3-5,8,11-14H2,1-2H3,(H,19,20).
What are the key properties of 1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide?
1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide has a molecular weight of 273.42 g/mol, XLogP of 3.98, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentyl-N-propyl-2,3-dihydroindene-1-carboxamide is sourced from PubChem (CID 54171569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).