C17H24INO — CID 54457633
1-(4-iodobutyl)-N-propyl-2,3-dihydroindene-1-carboxamide (PubChem CID 54457633) has the molecular formula C17H24INO and a molecular weight of 385.29 g/mol. Its IUPAC name is 1-(4-iodobutyl)-N-propyl-2,3-dihydroindene-1-carboxamide.
| Compound Name | 1-(4-iodobutyl)-N-propyl-2,3-dihydroindene-1-carboxamide |
|---|---|
| PubChem CID | 54457633 |
| Molecular Formula | C17H24INO |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 1-(4-iodobutyl)-N-propyl-2,3-dihydroindene-1-carboxamide |
| SMILES | CCCNC(=O)C1(CCCCI)CCc2ccccc21 |
| InChI | InChI=1S/C17H24INO/c1-2-13-19-16(20)17(10-5-6-12-18)11-9-14-7-3-4-8-15(14)17/h3-4,7-8H,2,5-6,9-13H2,1H3,(H,19,20) |
| InChIKey | WZIODZCVXJIFFK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|