C26H34BrN5O2 — CID 58425206
N-[[4-[[2-amino-4-(5-bromo-3-pyridinyl)-4-butyl-5-oxoimidazol-1-yl]methyl]phenyl]methyl]hexanamide (PubChem CID 58425206) has the molecular formula C26H34BrN5O2 and a molecular weight of 528.50 g/mol. Its IUPAC name is N-[[4-[[2-amino-4-(5-bromo-3-pyridinyl)-4-butyl-5-oxoimidazol-1-yl]methyl]phenyl]methyl]hexanamide.
| Compound Name | N-[[4-[[2-amino-4-(5-bromo-3-pyridinyl)-4-butyl-5-oxoimidazol-1-yl]methyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 58425206 |
| Molecular Formula | C26H34BrN5O2 |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | N-[[4-[[2-amino-4-(5-bromo-3-pyridinyl)-4-butyl-5-oxoimidazol-1-yl]methyl]phenyl]methyl]hexanamide |
| SMILES | CCCCCC(=O)NCc1ccc(CN2C(=O)C(CCCC)(c3cncc(Br)c3)N=C2N)cc1 |
| InChI | InChI=1S/C26H34BrN5O2/c1-3-5-7-8-23(33)30-15-19-9-11-20(12-10-19)18-32-24(34)26(13-6-4-2,31-25(32)28)21-14-22(27)17-29-16-21/h9-12,14,16-17H,3-8,13,15,18H2,1-2H3,(H2,28,31)(H,30,33) |
| InChIKey | ICXGXXSDVZFVIY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|