C27H35BrN4O2 — CID 58425038
N-[[4-[[2-amino-4-(3-bromophenyl)-4-butyl-5-oxoimidazol-1-yl]methyl]phenyl]methyl]hexanamide (PubChem CID 58425038) has the molecular formula C27H35BrN4O2 and a molecular weight of 527.51 g/mol. Its IUPAC name is N-[[4-[[2-amino-4-(3-bromophenyl)-4-butyl-5-oxoimidazol-1-yl]methyl]phenyl]methyl]hexanamide.
| Compound Name | N-[[4-[[2-amino-4-(3-bromophenyl)-4-butyl-5-oxoimidazol-1-yl]methyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 58425038 |
| Molecular Formula | C27H35BrN4O2 |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | N-[[4-[[2-amino-4-(3-bromophenyl)-4-butyl-5-oxoimidazol-1-yl]methyl]phenyl]methyl]hexanamide |
| SMILES | CCCCCC(=O)NCc1ccc(CN2C(=O)C(CCCC)(c3cccc(Br)c3)N=C2N)cc1 |
| InChI | InChI=1S/C27H35BrN4O2/c1-3-5-7-11-24(33)30-18-20-12-14-21(15-13-20)19-32-25(34)27(16-6-4-2,31-26(32)29)22-9-8-10-23(28)17-22/h8-10,12-15,17H,3-7,11,16,18-19H2,1-2H3,(H2,29,31)(H,30,33) |
| InChIKey | OCDKLDMJHBVNIN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|