C28H23Cl2N3O3 — CID 6195769
(4E)-5-(3,4-dichlorophenyl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione (PubChem CID 6195769) has the molecular formula C28H23Cl2N3O3 and a molecular weight of 520.42 g/mol. Its IUPAC name is (4E)-5-(3,4-dichlorophenyl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3,4-dichlorophenyl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6195769 |
| Molecular Formula | C28H23Cl2N3O3 |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | (4E)-5-(3,4-dichlorophenyl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cccn2c(C)c(/C(O)=C3\C(=O)C(=O)N(CCc4ccccc4)C3c3ccc(Cl)c(Cl)c3)nc12 |
| InChI | InChI=1S/C28H23Cl2N3O3/c1-16-7-6-13-32-17(2)23(31-27(16)32)25(34)22-24(19-10-11-20(29)21(30)15-19)33(28(36)26(22)35)14-12-18-8-4-3-5-9-18/h3-11,13,15,24,34H,12,14H2,1-2H3/b25-22+ |
| InChIKey | BGPLXJVPJUNNEE-YYDJUVGSSA-N |
| XLogP | 5.92 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|