C35H40N4O5 — CID 6195553
(4E)-1-[2-(diethylamino)ethyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-ethoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6195553) has the molecular formula C35H40N4O5 and a molecular weight of 596.73 g/mol. Its IUPAC name is (4E)-1-[2-(diethylamino)ethyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-ethoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-[2-(diethylamino)ethyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-ethoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6195553 |
| Molecular Formula | C35H40N4O5 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | (4E)-1-[2-(diethylamino)ethyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-ethoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2/C(=C(\O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2CCN(CC)CC)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H40N4O5/c1-6-37(7-2)19-20-39-31(26-16-17-27(28(21-26)43-8-3)44-22-25-14-10-9-11-15-25)29(33(41)35(39)42)32(40)30-24(5)38-18-12-13-23(4)34(38)36-30/h9-18,21,31,40H,6-8,19-20,22H2,1-5H3/b32-29+ |
| InChIKey | VHLRMRDGJQDXGX-UUDCSCGESA-N |
| XLogP | 5.69 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|