C32H34N4O4 — CID 6195522
(4E)-1-[2-(diethylamino)ethyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6195522) has the molecular formula C32H34N4O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is (4E)-1-[2-(diethylamino)ethyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-[2-(diethylamino)ethyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6195522 |
| Molecular Formula | C32H34N4O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | (4E)-1-[2-(diethylamino)ethyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)CCN1C(=O)C(=O)/C(=C(/O)c2nc3c(C)cccn3c2C)C1c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C32H34N4O4/c1-5-34(6-2)18-19-36-28(23-13-10-16-25(20-23)40-24-14-8-7-9-15-24)26(30(38)32(36)39)29(37)27-22(4)35-17-11-12-21(3)31(35)33-27/h7-17,20,28,37H,5-6,18-19H2,1-4H3/b29-26+ |
| InChIKey | SYJCTQCAIXNTCC-PBBVDAKRSA-N |
| XLogP | 5.51 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|