C29H36N4O4 — CID 6195529
(4E)-1-[2-(diethylamino)ethyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(4-propoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6195529) has the molecular formula C29H36N4O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is (4E)-1-[2-(diethylamino)ethyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(4-propoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-[2-(diethylamino)ethyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(4-propoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6195529 |
| Molecular Formula | C29H36N4O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | (4E)-1-[2-(diethylamino)ethyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(4-propoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1ccc(C2/C(=C(\O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2CCN(CC)CC)cc1 |
| InChI | InChI=1S/C29H36N4O4/c1-6-18-37-22-13-11-21(12-14-22)25-23(27(35)29(36)33(25)17-16-31(7-2)8-3)26(34)24-20(5)32-15-9-10-19(4)28(32)30-24/h9-15,25,34H,6-8,16-18H2,1-5H3/b26-23+ |
| InChIKey | JSGRLWIUDJGZNG-WNAAXNPUSA-N |
| XLogP | 4.50 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|